C16H18ClN3S — CID 80989884
6-(2-chlorophenyl)sulfanyl-2-cyclopropyl-N-ethyl-5-methylpyrimidin-4-amine (PubChem CID 80989884) has the molecular formula C16H18ClN3S and a molecular weight of 319.86 g/mol. Its IUPAC name is 6-(2-chlorophenyl)sulfanyl-2-cyclopropyl-N-ethyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-(2-chlorophenyl)sulfanyl-2-cyclopropyl-N-ethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80989884 |
| Molecular Formula | C16H18ClN3S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-(2-chlorophenyl)sulfanyl-2-cyclopropyl-N-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(C2CC2)nc(Sc2ccccc2Cl)c1C |
| InChI | InChI=1S/C16H18ClN3S/c1-3-18-14-10(2)16(20-15(19-14)11-8-9-11)21-13-7-5-4-6-12(13)17/h4-7,11H,3,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | WQSFHEJQFDYVKW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |