C15H17BrN4S — CID 80995476
6-[(5-bromo-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-ethyl-5-methylpyrimidin-4-amine (PubChem CID 80995476) has the molecular formula C15H17BrN4S and a molecular weight of 365.30 g/mol. Its IUPAC name is 6-[(5-bromo-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-ethyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-[(5-bromo-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-ethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80995476 |
| Molecular Formula | C15H17BrN4S |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 6-[(5-bromo-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(C2CC2)nc(Sc2ccc(Br)cn2)c1C |
| InChI | InChI=1S/C15H17BrN4S/c1-3-17-13-9(2)15(20-14(19-13)10-4-5-10)21-12-7-6-11(16)8-18-12/h6-8,10H,3-5H2,1-2H3,(H,17,19,20) |
| InChIKey | SCCPKWWYNHMXBL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |