C13H13ClFN3S — CID 80884181
5-chloro-4-(2-fluorophenyl)sulfanyl-N-propylpyrimidin-2-amine (PubChem CID 80884181) has the molecular formula C13H13ClFN3S and a molecular weight of 297.79 g/mol. Its IUPAC name is 5-chloro-4-(2-fluorophenyl)sulfanyl-N-propylpyrimidin-2-amine.
| Compound Name | 5-chloro-4-(2-fluorophenyl)sulfanyl-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80884181 |
| Molecular Formula | C13H13ClFN3S |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 5-chloro-4-(2-fluorophenyl)sulfanyl-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(Cl)c(Sc2ccccc2F)n1 |
| InChI | InChI=1S/C13H13ClFN3S/c1-2-7-16-13-17-8-9(14)12(18-13)19-11-6-4-3-5-10(11)15/h3-6,8H,2,7H2,1H3,(H,16,17,18) |
| InChIKey | QIWQQMGEYVYMEV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |