C10H11ClN4S2 — CID 80886409
5-chloro-N-propyl-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine (PubChem CID 80886409) has the molecular formula C10H11ClN4S2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 5-chloro-N-propyl-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-propyl-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80886409 |
| Molecular Formula | C10H11ClN4S2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 5-chloro-N-propyl-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine |
| SMILES | CCCNc1ncc(Cl)c(Sc2nccs2)n1 |
| InChI | InChI=1S/C10H11ClN4S2/c1-2-3-12-9-14-6-7(11)8(15-9)17-10-13-4-5-16-10/h4-6H,2-3H2,1H3,(H,12,14,15) |
| InChIKey | XRWFXEDMNWSRRA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|