C8H7ClN4S2 — CID 80886316
5-chloro-N-methyl-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine (PubChem CID 80886316) has the molecular formula C8H7ClN4S2 and a molecular weight of 258.76 g/mol. Its IUPAC name is 5-chloro-N-methyl-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-methyl-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80886316 |
| Molecular Formula | C8H7ClN4S2 |
| Molecular Weight | 258.76 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 5-chloro-N-methyl-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-amine |
| SMILES | CNc1ncc(Cl)c(Sc2nccs2)n1 |
| InChI | InChI=1S/C8H7ClN4S2/c1-10-7-12-4-5(9)6(13-7)15-8-11-2-3-14-8/h2-4H,1H3,(H,10,12,13) |
| InChIKey | OGKOMGQHSVUHMF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|