C8H6ClN3S2 — CID 115474613
6-chloro-2-(1,3-thiazol-2-ylsulfanyl)pyridin-3-amine (PubChem CID 115474613) has the molecular formula C8H6ClN3S2 and a molecular weight of 243.74 g/mol. Its IUPAC name is 6-chloro-2-(1,3-thiazol-2-ylsulfanyl)pyridin-3-amine.
| Compound Name | 6-chloro-2-(1,3-thiazol-2-ylsulfanyl)pyridin-3-amine |
|---|---|
| PubChem CID | 115474613 |
| Molecular Formula | C8H6ClN3S2 |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 6-chloro-2-(1,3-thiazol-2-ylsulfanyl)pyridin-3-amine |
| SMILES | Nc1ccc(Cl)nc1Sc1nccs1 |
| InChI | InChI=1S/C8H6ClN3S2/c9-6-2-1-5(10)7(12-6)14-8-11-3-4-13-8/h1-4H,10H2 |
| InChIKey | ZSEJLPVWTGLNQU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|