C11H8N4S2 — CID 80885673
4-(1,3-thiazol-2-ylsulfanyl)quinazolin-2-amine (PubChem CID 80885673) has the molecular formula C11H8N4S2 and a molecular weight of 260.35 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-ylsulfanyl)quinazolin-2-amine.
| Compound Name | 4-(1,3-thiazol-2-ylsulfanyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 80885673 |
| Molecular Formula | C11H8N4S2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 4-(1,3-thiazol-2-ylsulfanyl)quinazolin-2-amine |
| SMILES | Nc1nc(Sc2nccs2)c2ccccc2n1 |
| InChI | InChI=1S/C11H8N4S2/c12-10-14-8-4-2-1-3-7(8)9(15-10)17-11-13-5-6-16-11/h1-6H,(H2,12,14,15) |
| InChIKey | OQFNRUXJIFBQQB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|