C9H7N3O2S2 — CID 80885581
2-nitro-3-(1,3-thiazol-2-ylsulfanyl)aniline (PubChem CID 80885581) has the molecular formula C9H7N3O2S2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-nitro-3-(1,3-thiazol-2-ylsulfanyl)aniline.
| Compound Name | 2-nitro-3-(1,3-thiazol-2-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 80885581 |
| Molecular Formula | C9H7N3O2S2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2-nitro-3-(1,3-thiazol-2-ylsulfanyl)aniline |
| SMILES | Nc1cccc(Sc2nccs2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7N3O2S2/c10-6-2-1-3-7(8(6)12(13)14)16-9-11-4-5-15-9/h1-5H,10H2 |
| InChIKey | WAJITFMZVWFJCB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|