C16H10N2O3S2 — CID 51124763
[3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]-phenylmethanone (PubChem CID 51124763) has the molecular formula C16H10N2O3S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is [3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]-phenylmethanone.
| Compound Name | [3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 51124763 |
| Molecular Formula | C16H10N2O3S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | [3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(Sc2nccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10N2O3S2/c19-15(11-4-2-1-3-5-11)12-6-7-14(13(10-12)18(20)21)23-16-17-8-9-22-16/h1-10H |
| InChIKey | LGYWAAABVZLOIC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|