C14H10N4O3S2 — CID 133309573
(1-methylimidazol-2-yl)-[3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]methanone (PubChem CID 133309573) has the molecular formula C14H10N4O3S2 and a molecular weight of 346.39 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]methanone.
| Compound Name | (1-methylimidazol-2-yl)-[3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 133309573 |
| Molecular Formula | C14H10N4O3S2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | (1-methylimidazol-2-yl)-[3-nitro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]methanone |
| SMILES | Cn1ccnc1C(=O)c1ccc(Sc2nccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10N4O3S2/c1-17-6-4-15-13(17)12(19)9-2-3-11(10(8-9)18(20)21)23-14-16-5-7-22-14/h2-8H,1H3 |
| InChIKey | XOHKMTOECVLPSW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|