C17H16N6O3S2 — CID 133309571
(1-methylimidazol-2-yl)-[3-nitro-4-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]phenyl]methanone (PubChem CID 133309571) has the molecular formula C17H16N6O3S2 and a molecular weight of 416.49 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[3-nitro-4-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]phenyl]methanone.
| Compound Name | (1-methylimidazol-2-yl)-[3-nitro-4-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]phenyl]methanone |
|---|---|
| PubChem CID | 133309571 |
| Molecular Formula | C17H16N6O3S2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (1-methylimidazol-2-yl)-[3-nitro-4-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)sulfanyl]phenyl]methanone |
| SMILES | Cn1ccnc1C(=O)c1ccc(Sc2nnc(N3CCCC3)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N6O3S2/c1-21-9-6-18-15(21)14(24)11-4-5-13(12(10-11)23(25)26)27-17-20-19-16(28-17)22-7-2-3-8-22/h4-6,9-10H,2-3,7-8H2,1H3 |
| InChIKey | CLNAVWMOEGTLSD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|