C19H20N6O3 — CID 133275725
(1-methylimidazol-2-yl)-[3-nitro-4-(3-pyrazol-1-ylpiperidin-1-yl)phenyl]methanone (PubChem CID 133275725) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[3-nitro-4-(3-pyrazol-1-ylpiperidin-1-yl)phenyl]methanone.
| Compound Name | (1-methylimidazol-2-yl)-[3-nitro-4-(3-pyrazol-1-ylpiperidin-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 133275725 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (1-methylimidazol-2-yl)-[3-nitro-4-(3-pyrazol-1-ylpiperidin-1-yl)phenyl]methanone |
| SMILES | Cn1ccnc1C(=O)c1ccc(N2CCCC(n3cccn3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N6O3/c1-22-11-8-20-19(22)18(26)14-5-6-16(17(12-14)25(27)28)23-9-2-4-15(13-23)24-10-3-7-21-24/h3,5-8,10-12,15H,2,4,9,13H2,1H3 |
| InChIKey | SXTHUVMKNSTPTQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 99.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|