C22H27N7O3 — CID 133301816
(1-methylimidazol-2-yl)-[3-nitro-4-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazin-1-yl]phenyl]methanone (PubChem CID 133301816) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[3-nitro-4-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazin-1-yl]phenyl]methanone.
| Compound Name | (1-methylimidazol-2-yl)-[3-nitro-4-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazin-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 133301816 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (1-methylimidazol-2-yl)-[3-nitro-4-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]piperazin-1-yl]phenyl]methanone |
| SMILES | Cc1nn(C)c(C)c1CN1CCN(c2ccc(C(=O)c3nccn3C)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H27N7O3/c1-15-18(16(2)26(4)24-15)14-27-9-11-28(12-10-27)19-6-5-17(13-20(19)29(31)32)21(30)22-23-7-8-25(22)3/h5-8,13H,9-12,14H2,1-4H3 |
| InChIKey | GGZAWRPKAPXKIY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 102.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|