C21H27N5O4 — CID 133310911
(1-methylimidazol-2-yl)-[4-[2-(morpholin-4-ylmethyl)piperidin-1-yl]-3-nitrophenyl]methanone (PubChem CID 133310911) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[4-[2-(morpholin-4-ylmethyl)piperidin-1-yl]-3-nitrophenyl]methanone.
| Compound Name | (1-methylimidazol-2-yl)-[4-[2-(morpholin-4-ylmethyl)piperidin-1-yl]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 133310911 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (1-methylimidazol-2-yl)-[4-[2-(morpholin-4-ylmethyl)piperidin-1-yl]-3-nitrophenyl]methanone |
| SMILES | Cn1ccnc1C(=O)c1ccc(N2CCCCC2CN2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27N5O4/c1-23-9-7-22-21(23)20(27)16-5-6-18(19(14-16)26(28)29)25-8-3-2-4-17(25)15-24-10-12-30-13-11-24/h5-7,9,14,17H,2-4,8,10-13,15H2,1H3 |
| InChIKey | RNGKMESSKXMCHI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|