C21H24N6O4 — CID 86934630
[4-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-3-nitrophenyl]-(1-methylimidazol-2-yl)methanone (PubChem CID 86934630) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is [4-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-3-nitrophenyl]-(1-methylimidazol-2-yl)methanone.
| Compound Name | [4-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-3-nitrophenyl]-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 86934630 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | [4-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-3-nitrophenyl]-(1-methylimidazol-2-yl)methanone |
| SMILES | Cc1nc(CN2CCN(c3ccc(C(=O)c4nccn4C)cc3[N+](=O)[O-])CC2)oc1C |
| InChI | InChI=1S/C21H24N6O4/c1-14-15(2)31-19(23-14)13-25-8-10-26(11-9-25)17-5-4-16(12-18(17)27(29)30)20(28)21-22-6-7-24(21)3/h4-7,12H,8-11,13H2,1-3H3 |
| InChIKey | XESSSHFRHCROSI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 110.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|