C16H18N4O3 — CID 133336744
1-[4-[2-(imidazol-1-ylmethyl)pyrrolidin-1-yl]-3-nitrophenyl]ethanone (PubChem CID 133336744) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-[4-[2-(imidazol-1-ylmethyl)pyrrolidin-1-yl]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[2-(imidazol-1-ylmethyl)pyrrolidin-1-yl]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 133336744 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-[4-[2-(imidazol-1-ylmethyl)pyrrolidin-1-yl]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCCC2Cn2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N4O3/c1-12(21)13-4-5-15(16(9-13)20(22)23)19-7-2-3-14(19)10-18-8-6-17-11-18/h4-6,8-9,11,14H,2-3,7,10H2,1H3 |
| InChIKey | KNYCYVWQQMSPJS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|