C16H19N5O3 — CID 122139062
1-[3-nitro-4-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]phenyl]ethanone (PubChem CID 122139062) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 1-[3-nitro-4-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-nitro-4-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 122139062 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-[3-nitro-4-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCC(Cn3cncn3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N5O3/c1-12(22)14-2-3-15(16(8-14)21(23)24)19-6-4-13(5-7-19)9-20-11-17-10-18-20/h2-3,8,10-11,13H,4-7,9H2,1H3 |
| InChIKey | QPFLDPNRNNURQH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|