C20H27N3O4 — CID 26437045
1-[4-[4-(azepane-1-carbonyl)piperidin-1-yl]-3-nitrophenyl]ethanone (PubChem CID 26437045) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-[4-[4-(azepane-1-carbonyl)piperidin-1-yl]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[4-(azepane-1-carbonyl)piperidin-1-yl]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 26437045 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[4-[4-(azepane-1-carbonyl)piperidin-1-yl]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCC(C(=O)N3CCCCCC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H27N3O4/c1-15(24)17-6-7-18(19(14-17)23(26)27)21-12-8-16(9-13-21)20(25)22-10-4-2-3-5-11-22/h6-7,14,16H,2-5,8-13H2,1H3 |
| InChIKey | AGVIPVPIFWOQPE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|