C22H30N4O6S — CID 25328346
[4-[4-(azepan-1-yl)-3-nitrobenzoyl]piperazin-1-yl]-[(3S)-1,1-dioxothiolan-3-yl]methanone (PubChem CID 25328346) has the molecular formula C22H30N4O6S and a molecular weight of 478.57 g/mol. Its IUPAC name is [4-[4-(azepan-1-yl)-3-nitrobenzoyl]piperazin-1-yl]-[(3S)-1,1-dioxothiolan-3-yl]methanone.
| Compound Name | [4-[4-(azepan-1-yl)-3-nitrobenzoyl]piperazin-1-yl]-[(3S)-1,1-dioxothiolan-3-yl]methanone |
|---|---|
| PubChem CID | 25328346 |
| Molecular Formula | C22H30N4O6S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [4-[4-(azepan-1-yl)-3-nitrobenzoyl]piperazin-1-yl]-[(3S)-1,1-dioxothiolan-3-yl]methanone |
| SMILES | O=C(c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1)N1CCN(C(=O)[C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C22H30N4O6S/c27-21(24-10-12-25(13-11-24)22(28)18-7-14-33(31,32)16-18)17-5-6-19(20(15-17)26(29)30)23-8-3-1-2-4-9-23/h5-6,15,18H,1-4,7-14,16H2/t18-/m1/s1 |
| InChIKey | COFZTLGSEAWSKX-GOSISDBHSA-N |
| XLogP | 1.69 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|