C14H19N3O5S — CID 95622998
[(3S)-1-(4-acetyl-2-nitrophenyl)piperidin-3-yl]methanesulfonamide (PubChem CID 95622998) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is [(3S)-1-(4-acetyl-2-nitrophenyl)piperidin-3-yl]methanesulfonamide.
| Compound Name | [(3S)-1-(4-acetyl-2-nitrophenyl)piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 95622998 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [(3S)-1-(4-acetyl-2-nitrophenyl)piperidin-3-yl]methanesulfonamide |
| SMILES | CC(=O)c1ccc(N2CCC[C@H](CS(N)(=O)=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19N3O5S/c1-10(18)12-4-5-13(14(7-12)17(19)20)16-6-2-3-11(8-16)9-23(15,21)22/h4-5,7,11H,2-3,6,8-9H2,1H3,(H2,15,21,22)/t11-/m0/s1 |
| InChIKey | LWHILBDQINVPBV-NSHDSACASA-N |
| XLogP | 1.30 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|