C15H20BrNO — CID 62910168
1-[3-bromo-4-(3-ethylpiperidin-1-yl)phenyl]ethanone (PubChem CID 62910168) has the molecular formula C15H20BrNO and a molecular weight of 310.24 g/mol. Its IUPAC name is 1-[3-bromo-4-(3-ethylpiperidin-1-yl)phenyl]ethanone.
| Compound Name | 1-[3-bromo-4-(3-ethylpiperidin-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 62910168 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 1-[3-bromo-4-(3-ethylpiperidin-1-yl)phenyl]ethanone |
| SMILES | CCC1CCCN(c2ccc(C(C)=O)cc2Br)C1 |
| InChI | InChI=1S/C15H20BrNO/c1-3-12-5-4-8-17(10-12)15-7-6-13(11(2)18)9-14(15)16/h6-7,9,12H,3-5,8,10H2,1-2H3 |
| InChIKey | XAUBJSDZIJBALL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |