C14H19BrN2S — CID 82805181
3-bromo-4-(3-ethylpiperidin-1-yl)benzenecarbothioamide (PubChem CID 82805181) has the molecular formula C14H19BrN2S and a molecular weight of 327.29 g/mol. Its IUPAC name is 3-bromo-4-(3-ethylpiperidin-1-yl)benzenecarbothioamide.
| Compound Name | 3-bromo-4-(3-ethylpiperidin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 82805181 |
| Molecular Formula | C14H19BrN2S |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-bromo-4-(3-ethylpiperidin-1-yl)benzenecarbothioamide |
| SMILES | CCC1CCCN(c2ccc(C(N)=S)cc2Br)C1 |
| InChI | InChI=1S/C14H19BrN2S/c1-2-10-4-3-7-17(9-10)13-6-5-11(14(16)18)8-12(13)15/h5-6,8,10H,2-4,7,9H2,1H3,(H2,16,18) |
| InChIKey | OFFNVJDXWYSOEF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|