C18H24N2O5 — CID 133453177
1-[3-nitro-4-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]phenyl]ethanone (PubChem CID 133453177) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[3-nitro-4-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-nitro-4-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 133453177 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-[3-nitro-4-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCC(OCC3CCOC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N2O5/c1-13(21)15-2-3-17(18(10-15)20(22)23)19-7-4-16(5-8-19)25-12-14-6-9-24-11-14/h2-3,10,14,16H,4-9,11-12H2,1H3 |
| InChIKey | LMBWWNXTIHVTGP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|