C18H24N4O5 — CID 55659275
4-(4-acetylpiperazin-1-yl)-3-nitro-N-(oxolan-3-ylmethyl)benzamide (PubChem CID 55659275) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-3-nitro-N-(oxolan-3-ylmethyl)benzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-(oxolan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55659275 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-(oxolan-3-ylmethyl)benzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)NCC3CCOC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H24N4O5/c1-13(23)20-5-7-21(8-6-20)16-3-2-15(10-17(16)22(25)26)18(24)19-11-14-4-9-27-12-14/h2-3,10,14H,4-9,11-12H2,1H3,(H,19,24) |
| InChIKey | UXAFGYMHXPMKNR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|