C17H21BrN2O2 — CID 133453110
5-bromo-2-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]benzonitrile (PubChem CID 133453110) has the molecular formula C17H21BrN2O2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 5-bromo-2-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]benzonitrile.
| Compound Name | 5-bromo-2-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133453110 |
| Molecular Formula | C17H21BrN2O2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 5-bromo-2-[4-(oxolan-3-ylmethoxy)piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1cc(Br)ccc1N1CCC(OCC2CCOC2)CC1 |
| InChI | InChI=1S/C17H21BrN2O2/c18-15-1-2-17(14(9-15)10-19)20-6-3-16(4-7-20)22-12-13-5-8-21-11-13/h1-2,9,13,16H,3-8,11-12H2 |
| InChIKey | ALDKBFYSVDAJDY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |