C22H22N4O3 — CID 55877791
(4-imidazol-1-yl-3-nitrophenyl)-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone (PubChem CID 55877791) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is (4-imidazol-1-yl-3-nitrophenyl)-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-imidazol-1-yl-3-nitrophenyl)-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 55877791 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (4-imidazol-1-yl-3-nitrophenyl)-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-n2ccnc2)c([N+](=O)[O-])c1)N1CCCC1CCc1ccccc1 |
| InChI | InChI=1S/C22H22N4O3/c27-22(25-13-4-7-19(25)10-8-17-5-2-1-3-6-17)18-9-11-20(21(15-18)26(28)29)24-14-12-23-16-24/h1-3,5-6,9,11-12,14-16,19H,4,7-8,10,13H2 |
| InChIKey | XXCOTZYGPOJPHT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|