C15H17N5O3 — CID 119381080
(3-aminopiperidin-1-yl)-(4-imidazol-1-yl-3-nitrophenyl)methanone (PubChem CID 119381080) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(4-imidazol-1-yl-3-nitrophenyl)methanone.
| Compound Name | (3-aminopiperidin-1-yl)-(4-imidazol-1-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 119381080 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(4-imidazol-1-yl-3-nitrophenyl)methanone |
| SMILES | NC1CCCN(C(=O)c2ccc(-n3ccnc3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H17N5O3/c16-12-2-1-6-18(9-12)15(21)11-3-4-13(14(8-11)20(22)23)19-7-5-17-10-19/h3-5,7-8,10,12H,1-2,6,9,16H2 |
| InChIKey | KLTMOJHKDSIWIW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|