C16H13F3N4O5 — CID 120950683
(3S,4S)-1-(4-imidazol-1-yl-3-nitrobenzoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 120950683) has the molecular formula C16H13F3N4O5 and a molecular weight of 398.30 g/mol. Its IUPAC name is (3S,4S)-1-(4-imidazol-1-yl-3-nitrobenzoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(4-imidazol-1-yl-3-nitrobenzoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120950683 |
| Molecular Formula | C16H13F3N4O5 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (3S,4S)-1-(4-imidazol-1-yl-3-nitrobenzoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)c2ccc(-n3ccnc3)c([N+](=O)[O-])c2)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C16H13F3N4O5/c17-16(18,19)11-7-22(6-10(11)15(25)26)14(24)9-1-2-12(13(5-9)23(27)28)21-4-3-20-8-21/h1-5,8,10-11H,6-7H2,(H,25,26)/t10-,11-/m1/s1 |
| InChIKey | FIPYDACXZNGNOA-GHMZBOCLSA-N |
| XLogP | 2.12 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|