C19H29ClN4O3 — CID 119381387
(3-aminopiperidin-1-yl)-[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]methanone;hydrochloride (PubChem CID 119381387) has the molecular formula C19H29ClN4O3 and a molecular weight of 396.92 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119381387 |
| Molecular Formula | C19H29ClN4O3 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]methanone;hydrochloride |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)N3CCCC(N)C3)cc2[N+](=O)[O-])C1.Cl |
| InChI | InChI=1S/C19H28N4O3.ClH/c1-13-8-14(2)11-22(10-13)17-6-5-15(9-18(17)23(25)26)19(24)21-7-3-4-16(20)12-21;/h5-6,9,13-14,16H,3-4,7-8,10-12,20H2,1-2H3;1H |
| InChIKey | NKDFOZKWRQTITJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|