C24H37N5O3 — CID 112799516
[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]methanone (PubChem CID 112799516) has the molecular formula C24H37N5O3 and a molecular weight of 443.59 g/mol. Its IUPAC name is [4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]methanone.
| Compound Name | [4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112799516 |
| Molecular Formula | C24H37N5O3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | [4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]methanone |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)N3CCN(CCN4CCCC4)CC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C24H37N5O3/c1-19-15-20(2)18-28(17-19)22-6-5-21(16-23(22)29(31)32)24(30)27-13-11-26(12-14-27)10-9-25-7-3-4-8-25/h5-6,16,19-20H,3-4,7-15,17-18H2,1-2H3 |
| InChIKey | QBPZBJIMWOJBAW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|