C23H30N6O5 — CID 24572890
N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[4-(3-methylpiperidin-1-yl)-3-nitrobenzoyl]piperazin-1-yl]acetamide (PubChem CID 24572890) has the molecular formula C23H30N6O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[4-(3-methylpiperidin-1-yl)-3-nitrobenzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[4-(3-methylpiperidin-1-yl)-3-nitrobenzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24572890 |
| Molecular Formula | C23H30N6O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[4-(3-methylpiperidin-1-yl)-3-nitrobenzoyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cc(NC(=O)CN2CCN(C(=O)c3ccc(N4CCCC(C)C4)c([N+](=O)[O-])c3)CC2)no1 |
| InChI | InChI=1S/C23H30N6O5/c1-16-4-3-7-28(14-16)19-6-5-18(13-20(19)29(32)33)23(31)27-10-8-26(9-11-27)15-22(30)24-21-12-17(2)34-25-21/h5-6,12-13,16H,3-4,7-11,14-15H2,1-2H3,(H,24,25,30) |
| InChIKey | DBVLQUQQTOPLDD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|