C17H19FN6O5 — CID 55975422
2-[4-(2-amino-5-fluoro-3-nitrobenzoyl)piperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 55975422) has the molecular formula C17H19FN6O5 and a molecular weight of 406.37 g/mol. Its IUPAC name is 2-[4-(2-amino-5-fluoro-3-nitrobenzoyl)piperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[4-(2-amino-5-fluoro-3-nitrobenzoyl)piperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 55975422 |
| Molecular Formula | C17H19FN6O5 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[4-(2-amino-5-fluoro-3-nitrobenzoyl)piperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN2CCN(C(=O)c3cc(F)cc([N+](=O)[O-])c3N)CC2)no1 |
| InChI | InChI=1S/C17H19FN6O5/c1-10-6-14(21-29-10)20-15(25)9-22-2-4-23(5-3-22)17(26)12-7-11(18)8-13(16(12)19)24(27)28/h6-8H,2-5,9,19H2,1H3,(H,20,21,25) |
| InChIKey | RTQFORIGOZUJHB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|