C16H18FN5O6S — CID 47075567
2-[4-(2-fluoro-6-nitrophenyl)sulfonylpiperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 47075567) has the molecular formula C16H18FN5O6S and a molecular weight of 427.41 g/mol. Its IUPAC name is 2-[4-(2-fluoro-6-nitrophenyl)sulfonylpiperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[4-(2-fluoro-6-nitrophenyl)sulfonylpiperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 47075567 |
| Molecular Formula | C16H18FN5O6S |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-[4-(2-fluoro-6-nitrophenyl)sulfonylpiperazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN2CCN(S(=O)(=O)c3c(F)cccc3[N+](=O)[O-])CC2)no1 |
| InChI | InChI=1S/C16H18FN5O6S/c1-11-9-14(19-28-11)18-15(23)10-20-5-7-21(8-6-20)29(26,27)16-12(17)3-2-4-13(16)22(24)25/h2-4,9H,5-8,10H2,1H3,(H,18,19,23) |
| InChIKey | XMZFMSUBGJVUHS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 138.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|