C19H23N5O7S2 — CID 42999200
N-(5-methyl-1,2-oxazol-3-yl)-2-[2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]sulfanylpropanamide (PubChem CID 42999200) has the molecular formula C19H23N5O7S2 and a molecular weight of 497.56 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-[2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]sulfanylpropanamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 42999200 |
| Molecular Formula | C19H23N5O7S2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[2-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]sulfanylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)SCC(=O)N2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)no1 |
| InChI | InChI=1S/C19H23N5O7S2/c1-13-11-17(21-31-13)20-19(26)14(2)32-12-18(25)22-7-9-23(10-8-22)33(29,30)16-6-4-3-5-15(16)24(27)28/h3-6,11,14H,7-10,12H2,1-2H3,(H,20,21,26) |
| InChIKey | NSBBXMAUFJWFCN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 155.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|