C19H19ClFN5O4 — CID 52669343
2-[4-(2-amino-5-fluoro-3-nitrobenzoyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 52669343) has the molecular formula C19H19ClFN5O4 and a molecular weight of 435.84 g/mol. Its IUPAC name is 2-[4-(2-amino-5-fluoro-3-nitrobenzoyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-(2-amino-5-fluoro-3-nitrobenzoyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 52669343 |
| Molecular Formula | C19H19ClFN5O4 |
| Molecular Weight | 435.84 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-[4-(2-amino-5-fluoro-3-nitrobenzoyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | Nc1c(C(=O)N2CCN(CC(=O)Nc3ccccc3Cl)CC2)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClFN5O4/c20-14-3-1-2-4-15(14)23-17(27)11-24-5-7-25(8-6-24)19(28)13-9-12(21)10-16(18(13)22)26(29)30/h1-4,9-10H,5-8,11,22H2,(H,23,27) |
| InChIKey | OZFOUBXPUTYNTO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.84 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|