C19H23Cl3N4O2 — CID 119833686
2-[4-(3-aminobenzoyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide;dihydrochloride (PubChem CID 119833686) has the molecular formula C19H23Cl3N4O2 and a molecular weight of 445.78 g/mol. Its IUPAC name is 2-[4-(3-aminobenzoyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide;dihydrochloride.
| Compound Name | 2-[4-(3-aminobenzoyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119833686 |
| Molecular Formula | C19H23Cl3N4O2 |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 2-[4-(3-aminobenzoyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(C(=O)N2CCN(CC(=O)Nc3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H21ClN4O2.2ClH/c20-16-6-1-2-7-17(16)22-18(25)13-23-8-10-24(11-9-23)19(26)14-4-3-5-15(21)12-14;;/h1-7,12H,8-11,13,21H2,(H,22,25);2*1H |
| InChIKey | KZVAHYQRCGOOJF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|