C19H21Cl2N3O2 — CID 119754548
1-[4-(3-aminobenzoyl)piperazin-1-yl]-2-(2-chlorophenyl)ethanone;hydrochloride (PubChem CID 119754548) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 1-[4-(3-aminobenzoyl)piperazin-1-yl]-2-(2-chlorophenyl)ethanone;hydrochloride.
| Compound Name | 1-[4-(3-aminobenzoyl)piperazin-1-yl]-2-(2-chlorophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119754548 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-[4-(3-aminobenzoyl)piperazin-1-yl]-2-(2-chlorophenyl)ethanone;hydrochloride |
| SMILES | Cl.Nc1cccc(C(=O)N2CCN(C(=O)Cc3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H20ClN3O2.ClH/c20-17-7-2-1-4-14(17)13-18(24)22-8-10-23(11-9-22)19(25)15-5-3-6-16(21)12-15;/h1-7,12H,8-11,13,21H2;1H |
| InChIKey | KKTZUANPSDPWQE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|