C24H28ClN5O2 — CID 166364808
2-[4-[1-(3-aminopropyl)indole-5-carbonyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 166364808) has the molecular formula C24H28ClN5O2 and a molecular weight of 453.97 g/mol. Its IUPAC name is 2-[4-[1-(3-aminopropyl)indole-5-carbonyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-[1-(3-aminopropyl)indole-5-carbonyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 166364808 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-[4-[1-(3-aminopropyl)indole-5-carbonyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | NCCCn1ccc2cc(C(=O)N3CCN(CC(=O)Nc4ccccc4Cl)CC3)ccc21 |
| InChI | InChI=1S/C24H28ClN5O2/c25-20-4-1-2-5-21(20)27-23(31)17-28-12-14-30(15-13-28)24(32)19-6-7-22-18(16-19)8-11-29(22)10-3-9-26/h1-2,4-8,11,16H,3,9-10,12-15,17,26H2,(H,27,31) |
| InChIKey | AGVLSLNTPGDTLJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |