C21H20ClN3O2S — CID 8749038
2-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 8749038) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 2-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 8749038 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2cc3ccccc3s2)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C21H20ClN3O2S/c22-16-6-2-3-7-17(16)23-20(26)14-24-9-11-25(12-10-24)21(27)19-13-15-5-1-4-8-18(15)28-19/h1-8,13H,9-12,14H2,(H,23,26) |
| InChIKey | BUOWJOBJAXMNPD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |