C17H24ClN3OS — CID 120858098
[4-(2-amino-2-methylpropyl)piperazin-1-yl]-(1-benzothiophen-2-yl)methanone;hydrochloride (PubChem CID 120858098) has the molecular formula C17H24ClN3OS and a molecular weight of 353.92 g/mol. Its IUPAC name is [4-(2-amino-2-methylpropyl)piperazin-1-yl]-(1-benzothiophen-2-yl)methanone;hydrochloride.
| Compound Name | [4-(2-amino-2-methylpropyl)piperazin-1-yl]-(1-benzothiophen-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120858098 |
| Molecular Formula | C17H24ClN3OS |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [4-(2-amino-2-methylpropyl)piperazin-1-yl]-(1-benzothiophen-2-yl)methanone;hydrochloride |
| SMILES | CC(C)(N)CN1CCN(C(=O)c2cc3ccccc3s2)CC1.Cl |
| InChI | InChI=1S/C17H23N3OS.ClH/c1-17(2,18)12-19-7-9-20(10-8-19)16(21)15-11-13-5-3-4-6-14(13)22-15;/h3-6,11H,7-10,12,18H2,1-2H3;1H |
| InChIKey | TZQSBTJUXWNNBL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |