C21H33ClN4O3 — CID 119596427
[3-(1-aminoethyl)piperidin-1-yl]-[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]methanone;hydrochloride (PubChem CID 119596427) has the molecular formula C21H33ClN4O3 and a molecular weight of 424.97 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]methanone;hydrochloride.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119596427 |
| Molecular Formula | C21H33ClN4O3 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]methanone;hydrochloride |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)N3CCCC(C(C)N)C3)cc2[N+](=O)[O-])C1.Cl |
| InChI | InChI=1S/C21H32N4O3.ClH/c1-14-9-15(2)12-24(11-14)19-7-6-17(10-20(19)25(27)28)21(26)23-8-4-5-18(13-23)16(3)22;/h6-7,10,14-16,18H,4-5,8-9,11-13,22H2,1-3H3;1H |
| InChIKey | SHLPNMSXFOFLHO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|