C19H24F3N3O3 — CID 46655972
[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 46655972) has the molecular formula C19H24F3N3O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46655972 |
| Molecular Formula | C19H24F3N3O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | CC1CCN(c2ccc(C(=O)N3CCCC(C(F)(F)F)C3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H24F3N3O3/c1-13-6-9-23(10-7-13)16-5-4-14(11-17(16)25(27)28)18(26)24-8-2-3-15(12-24)19(20,21)22/h4-5,11,13,15H,2-3,6-10,12H2,1H3 |
| InChIKey | SPJVKZDJKZWKFM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|