C20H30N4O3 — CID 119563649
[4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]-[4-(methylamino)piperidin-1-yl]methanone (PubChem CID 119563649) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is [4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]-[4-(methylamino)piperidin-1-yl]methanone.
| Compound Name | [4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]-[4-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119563649 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [4-(3,5-dimethylpiperidin-1-yl)-3-nitrophenyl]-[4-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1CCN(C(=O)c2ccc(N3CC(C)CC(C)C3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-14-10-15(2)13-23(12-14)18-5-4-16(11-19(18)24(26)27)20(25)22-8-6-17(21-3)7-9-22/h4-5,11,14-15,17,21H,6-10,12-13H2,1-3H3 |
| InChIKey | ZQPYVVXHECFQNC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|