C15H17FN4O3 — CID 97332344
(3S)-1-(2-fluoro-5-methoxy-4-nitrophenyl)-3-pyrazol-1-ylpiperidine (PubChem CID 97332344) has the molecular formula C15H17FN4O3 and a molecular weight of 320.32 g/mol. Its IUPAC name is (3S)-1-(2-fluoro-5-methoxy-4-nitrophenyl)-3-pyrazol-1-ylpiperidine.
| Compound Name | (3S)-1-(2-fluoro-5-methoxy-4-nitrophenyl)-3-pyrazol-1-ylpiperidine |
|---|---|
| PubChem CID | 97332344 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (3S)-1-(2-fluoro-5-methoxy-4-nitrophenyl)-3-pyrazol-1-ylpiperidine |
| SMILES | COc1cc(N2CCC[C@H](n3cccn3)C2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17FN4O3/c1-23-15-9-13(12(16)8-14(15)20(21)22)18-6-2-4-11(10-18)19-7-3-5-17-19/h3,5,7-9,11H,2,4,6,10H2,1H3/t11-/m0/s1 |
| InChIKey | PZPOGGMQCKSLGT-NSHDSACASA-N |
| XLogP | 2.78 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|