C15H15F3N4O2 — CID 133275718
1-[4-nitro-2-(trifluoromethyl)phenyl]-3-pyrazol-1-ylpiperidine (PubChem CID 133275718) has the molecular formula C15H15F3N4O2 and a molecular weight of 340.31 g/mol. Its IUPAC name is 1-[4-nitro-2-(trifluoromethyl)phenyl]-3-pyrazol-1-ylpiperidine.
| Compound Name | 1-[4-nitro-2-(trifluoromethyl)phenyl]-3-pyrazol-1-ylpiperidine |
|---|---|
| PubChem CID | 133275718 |
| Molecular Formula | C15H15F3N4O2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-[4-nitro-2-(trifluoromethyl)phenyl]-3-pyrazol-1-ylpiperidine |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC(n3cccn3)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N4O2/c16-15(17,18)13-9-11(22(23)24)4-5-14(13)20-7-1-3-12(10-20)21-8-2-6-19-21/h2,4-6,8-9,12H,1,3,7,10H2 |
| InChIKey | WHFZPJKNISHFCX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|