C16H26F3N3O2 — CID 145278846
ethane;1-[4-nitro-2-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 145278846) has the molecular formula C16H26F3N3O2 and a molecular weight of 349.40 g/mol. Its IUPAC name is ethane;1-[4-nitro-2-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | ethane;1-[4-nitro-2-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 145278846 |
| Molecular Formula | C16H26F3N3O2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | ethane;1-[4-nitro-2-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | CC.CC.NC1CCN(c2ccc([N+](=O)[O-])cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H14F3N3O2.2C2H6/c13-12(14,15)10-7-9(18(19)20)1-2-11(10)17-5-3-8(16)4-6-17;2*1-2/h1-2,7-8H,3-6,16H2;2*1-2H3 |
| InChIKey | MXMRVHANFMTFHG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|