C17H18F3N5O2 — CID 133448776
4-(4-cyclopropyl-1,2,4-triazol-3-yl)-1-[4-nitro-2-(trifluoromethyl)phenyl]piperidine (PubChem CID 133448776) has the molecular formula C17H18F3N5O2 and a molecular weight of 381.36 g/mol. Its IUPAC name is 4-(4-cyclopropyl-1,2,4-triazol-3-yl)-1-[4-nitro-2-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 4-(4-cyclopropyl-1,2,4-triazol-3-yl)-1-[4-nitro-2-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 133448776 |
| Molecular Formula | C17H18F3N5O2 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-(4-cyclopropyl-1,2,4-triazol-3-yl)-1-[4-nitro-2-(trifluoromethyl)phenyl]piperidine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(c3nncn3C3CC3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N5O2/c18-17(19,20)14-9-13(25(26)27)3-4-15(14)23-7-5-11(6-8-23)16-22-21-10-24(16)12-1-2-12/h3-4,9-12H,1-2,5-8H2 |
| InChIKey | GOFOQTGSMWZIPA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|