C17H16F3N3O2 — CID 133301456
1-[4-nitro-2-(trifluoromethyl)phenyl]-N-phenylpyrrolidin-3-amine (PubChem CID 133301456) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 1-[4-nitro-2-(trifluoromethyl)phenyl]-N-phenylpyrrolidin-3-amine.
| Compound Name | 1-[4-nitro-2-(trifluoromethyl)phenyl]-N-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 133301456 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-[4-nitro-2-(trifluoromethyl)phenyl]-N-phenylpyrrolidin-3-amine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(Nc3ccccc3)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N3O2/c18-17(19,20)15-10-14(23(24)25)6-7-16(15)22-9-8-13(11-22)21-12-4-2-1-3-5-12/h1-7,10,13,21H,8-9,11H2 |
| InChIKey | OBEUVFJTLYQVMM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|