C17H21N5O3 — CID 133437842
[3-[4-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-4-nitrophenyl]methanol (PubChem CID 133437842) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is [3-[4-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-4-nitrophenyl]methanol.
| Compound Name | [3-[4-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 133437842 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [3-[4-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-4-nitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1N1CCC(c2nncn2C2CC2)CC1 |
| InChI | InChI=1S/C17H21N5O3/c23-10-12-1-4-15(22(24)25)16(9-12)20-7-5-13(6-8-20)17-19-18-11-21(17)14-2-3-14/h1,4,9,11,13-14,23H,2-3,5-8,10H2 |
| InChIKey | UWCOSEWJSAGHCW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|