C19H21ClN2O4 — CID 133437706
(4-chlorophenyl)-[1-[5-(hydroxymethyl)-2-nitrophenyl]piperidin-4-yl]methanol (PubChem CID 133437706) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is (4-chlorophenyl)-[1-[5-(hydroxymethyl)-2-nitrophenyl]piperidin-4-yl]methanol.
| Compound Name | (4-chlorophenyl)-[1-[5-(hydroxymethyl)-2-nitrophenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 133437706 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (4-chlorophenyl)-[1-[5-(hydroxymethyl)-2-nitrophenyl]piperidin-4-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1N1CCC(C(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21ClN2O4/c20-16-4-2-14(3-5-16)19(24)15-7-9-21(10-8-15)18-11-13(12-23)1-6-17(18)22(25)26/h1-6,11,15,19,23-24H,7-10,12H2 |
| InChIKey | DNPCJYPBHKPDFS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|